Carboxylic acids and derivatives
Filtered Search Results
N-(5-Bromopentyl)phthalimide, 97%
CAS: 954-81-4 Molecular Formula: C13H14BrNO2 Molecular Weight (g/mol): 296.164 MDL Number: MFCD00060522 InChI Key: QKVHAKICMNABGB-UHFFFAOYSA-N Synonym: n-5-bromopentyl phthalimide,2-5-bromopentyl isoindole-1,3-dione,n-5-bromopentyl-phthalimide,2-5-bromopentyl isoindoline-1,3-dione,2-5-bromo-pentyl-isoindole-1,3-dione,2-5-bromopentyl-1h-isoindole-1,3 2h-dione,2-5-bromopentyl-2,3-dihydro-1h-isoindole-1,3-dione,5-phthalimidopentyl bromide,1-bromo-5-phthalimidopentane PubChem CID: 136770 IUPAC Name: 2-(5-bromopentyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCBr
| PubChem CID | 136770 |
|---|---|
| CAS | 954-81-4 |
| Molecular Weight (g/mol) | 296.164 |
| MDL Number | MFCD00060522 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCCCBr |
| Synonym | n-5-bromopentyl phthalimide,2-5-bromopentyl isoindole-1,3-dione,n-5-bromopentyl-phthalimide,2-5-bromopentyl isoindoline-1,3-dione,2-5-bromo-pentyl-isoindole-1,3-dione,2-5-bromopentyl-1h-isoindole-1,3 2h-dione,2-5-bromopentyl-2,3-dihydro-1h-isoindole-1,3-dione,5-phthalimidopentyl bromide,1-bromo-5-phthalimidopentane |
| IUPAC Name | 2-(5-bromopentyl)isoindole-1,3-dione |
| InChI Key | QKVHAKICMNABGB-UHFFFAOYSA-N |
| Molecular Formula | C13H14BrNO2 |
Methyl 2-(bromomethyl)acrylate, 96%
CAS: 4224-69-5 Molecular Formula: C5H7BrO2 Molecular Weight (g/mol): 179.01 MDL Number: MFCD00011697 InChI Key: CFTUQSLVERGMHL-UHFFFAOYSA-N Synonym: methyl 2-bromomethyl acrylate,methyl 2-bromomethyl prop-2-enoate,methyl 2-bromomethyl-2-propenoate,methyl alpha-bromomethyl acrylate,2-bromomethyl methyl acrylate,2-propenoic acid, 2-bromomethyl-, methyl ester,2-bromomethyl acrylic acid methyl ester,acrylic acid, 2-bromomethyl-, methyl ester,zlchem 195,pubchem17371 PubChem CID: 521093 IUPAC Name: methyl 2-(bromomethyl)prop-2-enoate SMILES: COC(=O)C(=C)CBr
| PubChem CID | 521093 |
|---|---|
| CAS | 4224-69-5 |
| Molecular Weight (g/mol) | 179.01 |
| MDL Number | MFCD00011697 |
| SMILES | COC(=O)C(=C)CBr |
| Synonym | methyl 2-bromomethyl acrylate,methyl 2-bromomethyl prop-2-enoate,methyl 2-bromomethyl-2-propenoate,methyl alpha-bromomethyl acrylate,2-bromomethyl methyl acrylate,2-propenoic acid, 2-bromomethyl-, methyl ester,2-bromomethyl acrylic acid methyl ester,acrylic acid, 2-bromomethyl-, methyl ester,zlchem 195,pubchem17371 |
| IUPAC Name | methyl 2-(bromomethyl)prop-2-enoate |
| InChI Key | CFTUQSLVERGMHL-UHFFFAOYSA-N |
| Molecular Formula | C5H7BrO2 |
Methyl Acetate, Technical, Approx. 75%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
trans-2-Butenyl acetate, 95%
CAS: 628-08-0 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00039912 InChI Key: WNHXJHGRIHUOTG-ONEGZZNKSA-N Synonym: trans-2-butenyl acetate,crotyl acetate,e-2-butenyl acetate,2-buten-1-ol, acetate,e-crotyl acetate,e-but-2-enyl acetate,2-buten-1-ol, acetate, 2e,2-buten-1-ol, 1-acetate, 2e,2e-but-2-en-1-yl acetate,e-2-buten-1-yl acetate PubChem CID: 5363082 IUPAC Name: [(E)-but-2-enyl] acetate SMILES: CC=CCOC(=O)C
| PubChem CID | 5363082 |
|---|---|
| CAS | 628-08-0 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00039912 |
| SMILES | CC=CCOC(=O)C |
| Synonym | trans-2-butenyl acetate,crotyl acetate,e-2-butenyl acetate,2-buten-1-ol, acetate,e-crotyl acetate,e-but-2-enyl acetate,2-buten-1-ol, acetate, 2e,2-buten-1-ol, 1-acetate, 2e,2e-but-2-en-1-yl acetate,e-2-buten-1-yl acetate |
| IUPAC Name | [(E)-but-2-enyl] acetate |
| InChI Key | WNHXJHGRIHUOTG-ONEGZZNKSA-N |
| Molecular Formula | C6H10O2 |
2-Propylpentanoic acid, 99%
CAS: 99-66-1 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 MDL Number: MFCD00002672 InChI Key: NIJJYAXOARWZEE-UHFFFAOYSA-N Synonym: valproic acid,dipropylacetic acid,depakene,depakine,2-propylvaleric acid,ergenyl,di-n-propylacetic acid,valproate,mylproin,pentanoic acid, 2-propyl PubChem CID: 3121 ChEBI: CHEBI:39867 IUPAC Name: 2-propylpentanoic acid SMILES: CCCC(CCC)C(O)=O
| PubChem CID | 3121 |
|---|---|
| CAS | 99-66-1 |
| Molecular Weight (g/mol) | 144.21 |
| ChEBI | CHEBI:39867 |
| MDL Number | MFCD00002672 |
| SMILES | CCCC(CCC)C(O)=O |
| Synonym | valproic acid,dipropylacetic acid,depakene,depakine,2-propylvaleric acid,ergenyl,di-n-propylacetic acid,valproate,mylproin,pentanoic acid, 2-propyl |
| IUPAC Name | 2-propylpentanoic acid |
| InChI Key | NIJJYAXOARWZEE-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
2-Naphthylacetic acid, 99%
CAS: 581-96-4 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004126 InChI Key: VIBOGIYPPWLDTI-UHFFFAOYSA-N Synonym: 2-naphthylacetic acid,2-naphthaleneacetic acid,2-naphthalen-2-yl acetic acid,betoxan,2-2-naphthyl acetic acid,beta-naphthylacetic acid,beta-naphthaleneacetic acid,beta-naphthaleneacetate,naphthalen-2-ylacetic acid,.beta.-naphthaleneacetic acid PubChem CID: 11393 ChEBI: CHEBI:37837 IUPAC Name: 2-naphthalen-2-ylacetic acid SMILES: OC(=O)CC1=CC=C2C=CC=CC2=C1
| PubChem CID | 11393 |
|---|---|
| CAS | 581-96-4 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:37837 |
| MDL Number | MFCD00004126 |
| SMILES | OC(=O)CC1=CC=C2C=CC=CC2=C1 |
| Synonym | 2-naphthylacetic acid,2-naphthaleneacetic acid,2-naphthalen-2-yl acetic acid,betoxan,2-2-naphthyl acetic acid,beta-naphthylacetic acid,beta-naphthaleneacetic acid,beta-naphthaleneacetate,naphthalen-2-ylacetic acid,.beta.-naphthaleneacetic acid |
| IUPAC Name | 2-naphthalen-2-ylacetic acid |
| InChI Key | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
| CAS | 3891-07-4 |
|---|---|
| MDL Number | MFCD00005903 |
1-Acetamidoadamantane, 98%
CAS: 880-52-4 Molecular Formula: C12H19NO Molecular Weight (g/mol): 193.29 MDL Number: MFCD00074730 InChI Key: BCVXYGJCDZPKGV-UHFFFAOYSA-N Synonym: 1-acetamidoadamantane,n-1-adamantyl acetamide,n-adamantan-1-yl acetamide,1-acetylaminoadamantane,1-adamantylacetamide,acetamide, n-1-adamantyl,n-adamantylacetamide,1-acetamino adamantane,unii-5283y1voii,n-acetyl adamantamine PubChem CID: 64153 IUPAC Name: N-(1-adamantyl)acetamide SMILES: CC(=O)NC12CC3CC(C1)CC(C3)C2
| PubChem CID | 64153 |
|---|---|
| CAS | 880-52-4 |
| Molecular Weight (g/mol) | 193.29 |
| MDL Number | MFCD00074730 |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)C2 |
| Synonym | 1-acetamidoadamantane,n-1-adamantyl acetamide,n-adamantan-1-yl acetamide,1-acetylaminoadamantane,1-adamantylacetamide,acetamide, n-1-adamantyl,n-adamantylacetamide,1-acetamino adamantane,unii-5283y1voii,n-acetyl adamantamine |
| IUPAC Name | N-(1-adamantyl)acetamide |
| InChI Key | BCVXYGJCDZPKGV-UHFFFAOYSA-N |
| Molecular Formula | C12H19NO |
4-n-Butylbenzamide, 97%
CAS: 107377-07-1 Molecular Formula: C11H15NO Molecular Weight (g/mol): 177.247 MDL Number: MFCD00221466 InChI Key: KFINRIKJBULSTD-UHFFFAOYSA-N Synonym: 4-n-butylbenzamide,benzamide, 4-butyl,p-butylbenzamid,acmc-20e7n2 PubChem CID: 2801458 IUPAC Name: 4-butylbenzamide SMILES: CCCCC1=CC=C(C=C1)C(=O)N
| PubChem CID | 2801458 |
|---|---|
| CAS | 107377-07-1 |
| Molecular Weight (g/mol) | 177.247 |
| MDL Number | MFCD00221466 |
| SMILES | CCCCC1=CC=C(C=C1)C(=O)N |
| Synonym | 4-n-butylbenzamide,benzamide, 4-butyl,p-butylbenzamid,acmc-20e7n2 |
| IUPAC Name | 4-butylbenzamide |
| InChI Key | KFINRIKJBULSTD-UHFFFAOYSA-N |
| Molecular Formula | C11H15NO |
1,1,1,3,3,3-Hexafluoroisopropyl methacrylate, 99%, stab.
CAS: 3063-94-3 Molecular Formula: C7H6F6O2 Molecular Weight (g/mol): 236.113 MDL Number: MFCD00040105 InChI Key: FMQPBWHSNCRVQJ-UHFFFAOYSA-N Synonym: hexafluoroisopropyl methacrylate,1,1,1,3,3,3-hexafluoroisopropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,methacrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,2,2,2-trifluoro-1-trifluoromethyl ethyl methacrylate,hexafluoro-2-propyl methacrylate,1h-1-trifluoromethyl trifluoroethyl methacrylate,1,1,1,3,3,3-hexafluoroprop-2-yl 2-methylprop-2-enoate,1,1,1,3,3,3-hexafluoro-2-propanyl methacrylate,hfipma PubChem CID: 76469 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC(C(F)(F)F)C(F)(F)F
| PubChem CID | 76469 |
|---|---|
| CAS | 3063-94-3 |
| Molecular Weight (g/mol) | 236.113 |
| MDL Number | MFCD00040105 |
| SMILES | CC(=C)C(=O)OC(C(F)(F)F)C(F)(F)F |
| Synonym | hexafluoroisopropyl methacrylate,1,1,1,3,3,3-hexafluoroisopropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoro-1-trifluoromethyl ethyl ester,methacrylic acid 1,1,1,3,3,3-hexafluoroisopropyl ester,2,2,2-trifluoro-1-trifluoromethyl ethyl methacrylate,hexafluoro-2-propyl methacrylate,1h-1-trifluoromethyl trifluoroethyl methacrylate,1,1,1,3,3,3-hexafluoroprop-2-yl 2-methylprop-2-enoate,1,1,1,3,3,3-hexafluoro-2-propanyl methacrylate,hfipma |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-methylprop-2-enoate |
| InChI Key | FMQPBWHSNCRVQJ-UHFFFAOYSA-N |
| Molecular Formula | C7H6F6O2 |
Ethyl 4-pyridineacetate, 98%
CAS: 54401-85-3 Molecular Formula: C9H11NO2 Molecular Weight (g/mol): 165.192 MDL Number: MFCD00051830 InChI Key: QVLJLWHOILVHJJ-UHFFFAOYSA-N Synonym: ethyl 4-pyridylacetate,ethyl 2-pyridin-4-yl acetate,ethyl pyridine-4-acetate,ethyl pyridin-4-ylacetate,4-pyridineacetic acid ethyl ester,4-pyridineacetic acid, ethyl ester,ethyl 2-4-pyridyl acetate,4-pyridylacetic acid ethyl ester,ethyl 4-pyridineacetate,ethyl-4-pyridylacetate PubChem CID: 736321 IUPAC Name: ethyl 2-pyridin-4-ylacetate SMILES: CCOC(=O)CC1=CC=NC=C1
| PubChem CID | 736321 |
|---|---|
| CAS | 54401-85-3 |
| Molecular Weight (g/mol) | 165.192 |
| MDL Number | MFCD00051830 |
| SMILES | CCOC(=O)CC1=CC=NC=C1 |
| Synonym | ethyl 4-pyridylacetate,ethyl 2-pyridin-4-yl acetate,ethyl pyridine-4-acetate,ethyl pyridin-4-ylacetate,4-pyridineacetic acid ethyl ester,4-pyridineacetic acid, ethyl ester,ethyl 2-4-pyridyl acetate,4-pyridylacetic acid ethyl ester,ethyl 4-pyridineacetate,ethyl-4-pyridylacetate |
| IUPAC Name | ethyl 2-pyridin-4-ylacetate |
| InChI Key | QVLJLWHOILVHJJ-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2 |
2,2,3,3-d(4)-3-(Trimethylsilyl)propionic acid sodium salt, 98+ atom % D
CAS: 24493-21-8 Molecular Formula: C6H13NaO2Si Molecular Weight (g/mol): 172.267 MDL Number: MFCD00002762 InChI Key: OIIWPAYIXDCDNL-HGFPCDIYSA-M Synonym: sodium 3-trimethylsilyl 2,2,3,3-2h4 propionate,3-trimethylsilyl propionic acid-d4 sodium salt,2,2,3,3-d4-3-trimethylsilyl propionic acid sodium salt,sodium 3-trimethylsilyl 2 h? propanoate,sodium 3-trimethylsilyl 2h4 propanoate,tsp-d4,propanoic-2,2,3,3-d4 acid, 3-trimethylsilyl-, sodium salt,sodium 3-trimethylsilyl propionate-2,2,3,3-d4,3-trimethylsilyl propionic-2,2,3,3-d4 acid sodium salt,sodium-3-trimethylsilyl-2,2,3,3-tetradeuteriopropionate PubChem CID: 23688921 IUPAC Name: sodium;2,2,3,3-tetradeuterio-3-trimethylsilylpropanoate SMILES: C[Si](C)(C)CCC(=O)[O-].[Na+]
| PubChem CID | 23688921 |
|---|---|
| CAS | 24493-21-8 |
| Molecular Weight (g/mol) | 172.267 |
| MDL Number | MFCD00002762 |
| SMILES | C[Si](C)(C)CCC(=O)[O-].[Na+] |
| Synonym | sodium 3-trimethylsilyl 2,2,3,3-2h4 propionate,3-trimethylsilyl propionic acid-d4 sodium salt,2,2,3,3-d4-3-trimethylsilyl propionic acid sodium salt,sodium 3-trimethylsilyl 2 h? propanoate,sodium 3-trimethylsilyl 2h4 propanoate,tsp-d4,propanoic-2,2,3,3-d4 acid, 3-trimethylsilyl-, sodium salt,sodium 3-trimethylsilyl propionate-2,2,3,3-d4,3-trimethylsilyl propionic-2,2,3,3-d4 acid sodium salt,sodium-3-trimethylsilyl-2,2,3,3-tetradeuteriopropionate |
| IUPAC Name | sodium;2,2,3,3-tetradeuterio-3-trimethylsilylpropanoate |
| InChI Key | OIIWPAYIXDCDNL-HGFPCDIYSA-M |
| Molecular Formula | C6H13NaO2Si |
4-Dimethylaminobenzhydrazide, 98+%
CAS: 19353-92-5 Molecular Formula: C9H13N3O Molecular Weight (g/mol): 179.223 MDL Number: MFCD00014761 InChI Key: HITIGLAGJBMISF-UHFFFAOYSA-N Synonym: 4-dimethylamino benzohydrazide,4-dimethylamino benzhydrazide,4-dimethylaminobenzhydrazide,p-dimethylamino benzohydrazide,4-n,n-dimethylamino benzhydrazide,dimethyl 4-???phenyl amine,4me2nphcon2,acmc-1bqxb,maybridge1_002636,4-dimethylaminobenzoic acid, hydrazide PubChem CID: 88019 IUPAC Name: 4-(dimethylamino)benzohydrazide SMILES: CN(C)C1=CC=C(C=C1)C(=O)NN
| PubChem CID | 88019 |
|---|---|
| CAS | 19353-92-5 |
| Molecular Weight (g/mol) | 179.223 |
| MDL Number | MFCD00014761 |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)NN |
| Synonym | 4-dimethylamino benzohydrazide,4-dimethylamino benzhydrazide,4-dimethylaminobenzhydrazide,p-dimethylamino benzohydrazide,4-n,n-dimethylamino benzhydrazide,dimethyl 4-???phenyl amine,4me2nphcon2,acmc-1bqxb,maybridge1_002636,4-dimethylaminobenzoic acid, hydrazide |
| IUPAC Name | 4-(dimethylamino)benzohydrazide |
| InChI Key | HITIGLAGJBMISF-UHFFFAOYSA-N |
| Molecular Formula | C9H13N3O |
Ethyl levulinate, 98%
CAS: 539-88-8 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00009209 InChI Key: GMEONFUTDYJSNV-UHFFFAOYSA-N Synonym: ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate PubChem CID: 10883 IUPAC Name: ethyl 4-oxopentanoate SMILES: CCOC(=O)CCC(C)=O
| PubChem CID | 10883 |
|---|---|
| CAS | 539-88-8 |
| Molecular Weight (g/mol) | 144.17 |
| MDL Number | MFCD00009209 |
| SMILES | CCOC(=O)CCC(C)=O |
| Synonym | ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate |
| IUPAC Name | ethyl 4-oxopentanoate |
| InChI Key | GMEONFUTDYJSNV-UHFFFAOYSA-N |
| Molecular Formula | C7H12O3 |